About N-(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methanesulfonamide
N-(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methanesulfonamide (PubChem CID 18679763) has the molecular formula C11H13NO3S
and a molecular weight of 239.30 g/mol. Its IUPAC name is N-(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methanesulfonamide |
| PubChem CID | 18679763 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | N-(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc2c1CCCC2=O |
| InChI | InChI=1S/C11H13NO3S/c1-16(14,15)12-10-6-2-5-9-8(10)4-3-7-11(9)13/h2,5-6,12H,3-4,7H2,1H3 |
| InChIKey | MXAFEWCLNMUVHL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methanesulfonamide?
The IUPAC name of N-(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methanesulfonamide (CID 18679763) is N-(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methanesulfonamide.
What is the SMILES notation for N-(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methanesulfonamide?
The canonical SMILES for N-(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methanesulfonamide is CS(=O)(=O)Nc1cccc2c1CCCC2=O.
What is the InChIKey of N-(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methanesulfonamide?
The InChIKey is MXAFEWCLNMUVHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3S/c1-16(14,15)12-10-6-2-5-9-8(10)4-3-7-11(9)13/h2,5-6,12H,3-4,7H2,1H3.
What are the key properties of N-(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methanesulfonamide?
N-(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methanesulfonamide has a molecular weight of 239.30 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)methanesulfonamide is sourced from PubChem (CID 18679763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).