C12H14O — CID 18679856
(4aZ)-7,8,9,10-tetrahydro-4H-benzo[8]annulen-6-one (PubChem CID 18679856) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is (4aZ)-7,8,9,10-tetrahydro-4H-benzo[8]annulen-6-one.
| Compound Name | (4aZ)-7,8,9,10-tetrahydro-4H-benzo[8]annulen-6-one |
|---|---|
| PubChem CID | 18679856 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (4aZ)-7,8,9,10-tetrahydro-4H-benzo[8]annulen-6-one |
| SMILES | O=C1/C=C2/CC=CC=C2CCCC1 |
| InChI | InChI=1S/C12H14O/c13-12-8-4-3-6-10-5-1-2-7-11(10)9-12/h1-2,5,9H,3-4,6-8H2/b11-9- |
| InChIKey | XGUUDRCVSPOPFY-LUAWRHEFSA-N |
| XLogP | 2.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |