About 7-bromo-1-propan-2-yl-3,4-dihydroisoquinoline
7-bromo-1-propan-2-yl-3,4-dihydroisoquinoline (PubChem CID 18680068) has the molecular formula C12H14BrN
and a molecular weight of 252.15 g/mol. Its IUPAC name is 7-bromo-1-propan-2-yl-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 7-bromo-1-propan-2-yl-3,4-dihydroisoquinoline |
| PubChem CID | 18680068 |
| Molecular Formula | C12H14BrN |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 7-bromo-1-propan-2-yl-3,4-dihydroisoquinoline |
| SMILES | CC(C)C1=NCCc2ccc(Br)cc21 |
| InChI | InChI=1S/C12H14BrN/c1-8(2)12-11-7-10(13)4-3-9(11)5-6-14-12/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | LTMLXRYRVYESQC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromo-1-propan-2-yl-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-propan-2-yl-3,4-dihydroisoquinoline?
The IUPAC name of 7-bromo-1-propan-2-yl-3,4-dihydroisoquinoline (CID 18680068) is 7-bromo-1-propan-2-yl-3,4-dihydroisoquinoline.
What is the SMILES notation for 7-bromo-1-propan-2-yl-3,4-dihydroisoquinoline?
The canonical SMILES for 7-bromo-1-propan-2-yl-3,4-dihydroisoquinoline is CC(C)C1=NCCc2ccc(Br)cc21.
What is the InChIKey of 7-bromo-1-propan-2-yl-3,4-dihydroisoquinoline?
The InChIKey is LTMLXRYRVYESQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrN/c1-8(2)12-11-7-10(13)4-3-9(11)5-6-14-12/h3-4,7-8H,5-6H2,1-2H3.
What are the key properties of 7-bromo-1-propan-2-yl-3,4-dihydroisoquinoline?
7-bromo-1-propan-2-yl-3,4-dihydroisoquinoline has a molecular weight of 252.15 g/mol, XLogP of 3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-propan-2-yl-3,4-dihydroisoquinoline is sourced from PubChem (CID 18680068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).