About 4-methyl-4-[(1-methylcyclohexyl)methyl]-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid
4-methyl-4-[(1-methylcyclohexyl)methyl]-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid (PubChem CID 18680294) has the molecular formula C16H24O4
and a molecular weight of 280.36 g/mol. Its IUPAC name is 4-methyl-4-[(1-methylcyclohexyl)methyl]-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-methyl-4-[(1-methylcyclohexyl)methyl]-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid |
| PubChem CID | 18680294 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 4-methyl-4-[(1-methylcyclohexyl)methyl]-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid |
| SMILES | CC1(CC2(C)CC34OC3(CC2C(=O)O)O4)CCCCC1 |
| InChI | InChI=1S/C16H24O4/c1-13(6-4-3-5-7-13)9-14(2)10-16-15(19-16,20-16)8-11(14)12(17)18/h11H,3-10H2,1-2H3,(H,17,18) |
| InChIKey | NJCHXWIXUZFZJM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-4-[(1-methylcyclohexyl)methyl]-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4-[(1-methylcyclohexyl)methyl]-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid?
The IUPAC name of 4-methyl-4-[(1-methylcyclohexyl)methyl]-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid (CID 18680294) is 4-methyl-4-[(1-methylcyclohexyl)methyl]-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid.
What is the SMILES notation for 4-methyl-4-[(1-methylcyclohexyl)methyl]-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid?
The canonical SMILES for 4-methyl-4-[(1-methylcyclohexyl)methyl]-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid is CC1(CC2(C)CC34OC3(CC2C(=O)O)O4)CCCCC1.
What is the InChIKey of 4-methyl-4-[(1-methylcyclohexyl)methyl]-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid?
The InChIKey is NJCHXWIXUZFZJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O4/c1-13(6-4-3-5-7-13)9-14(2)10-16-15(19-16,20-16)8-11(14)12(17)18/h11H,3-10H2,1-2H3,(H,17,18).
What are the key properties of 4-methyl-4-[(1-methylcyclohexyl)methyl]-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid?
4-methyl-4-[(1-methylcyclohexyl)methyl]-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid has a molecular weight of 280.36 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4-[(1-methylcyclohexyl)methyl]-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid is sourced from PubChem (CID 18680294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).