About 3-amino-6,6-dimethylazepan-2-one
3-amino-6,6-dimethylazepan-2-one (PubChem CID 18680346) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 3-amino-6,6-dimethylazepan-2-one.
Molecular Properties
| Compound Name | 3-amino-6,6-dimethylazepan-2-one |
| PubChem CID | 18680346 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 3-amino-6,6-dimethylazepan-2-one |
| SMILES | CC1(C)CCC(N)C(=O)NC1 |
| InChI | InChI=1S/C8H16N2O/c1-8(2)4-3-6(9)7(11)10-5-8/h6H,3-5,9H2,1-2H3,(H,10,11) |
| InChIKey | DAAUVPACSPNLFT-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-6,6-dimethylazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6,6-dimethylazepan-2-one?
The IUPAC name of 3-amino-6,6-dimethylazepan-2-one (CID 18680346) is 3-amino-6,6-dimethylazepan-2-one.
What is the SMILES notation for 3-amino-6,6-dimethylazepan-2-one?
The canonical SMILES for 3-amino-6,6-dimethylazepan-2-one is CC1(C)CCC(N)C(=O)NC1.
What is the InChIKey of 3-amino-6,6-dimethylazepan-2-one?
The InChIKey is DAAUVPACSPNLFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-8(2)4-3-6(9)7(11)10-5-8/h6H,3-5,9H2,1-2H3,(H,10,11).
What are the key properties of 3-amino-6,6-dimethylazepan-2-one?
3-amino-6,6-dimethylazepan-2-one has a molecular weight of 156.23 g/mol, XLogP of 0.25, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6,6-dimethylazepan-2-one is sourced from PubChem (CID 18680346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).