C9H7F5 — CID 18680649
1,2,3,4,5-pentafluoro-6-propylbenzene (PubChem CID 18680649) has the molecular formula C9H7F5 and a molecular weight of 210.14 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-propylbenzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-propylbenzene |
|---|---|
| PubChem CID | 18680649 |
| Molecular Formula | C9H7F5 |
| Molecular Weight | 210.14 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-propylbenzene |
| SMILES | CCCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H7F5/c1-2-3-4-5(10)7(12)9(14)8(13)6(4)11/h2-3H2,1H3 |
| InChIKey | LJEHGOAHCQTFBY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.14 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|