C24H22N2O2 — CID 18681064
ethyl 2-methyl-3-[(2-phenylphenyl)methyl]benzimidazole-5-carboxylate (PubChem CID 18681064) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is ethyl 2-methyl-3-[(2-phenylphenyl)methyl]benzimidazole-5-carboxylate.
| Compound Name | ethyl 2-methyl-3-[(2-phenylphenyl)methyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 18681064 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | ethyl 2-methyl-3-[(2-phenylphenyl)methyl]benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(C)n(Cc3ccccc3-c3ccccc3)c2c1 |
| InChI | InChI=1S/C24H22N2O2/c1-3-28-24(27)19-13-14-22-23(15-19)26(17(2)25-22)16-20-11-7-8-12-21(20)18-9-5-4-6-10-18/h4-15H,3,16H2,1-2H3 |
| InChIKey | OXNSWCMRHCSKTI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |