About 1-ethoxy-2,3-difluoro-4-[4-(4-propylcyclohexyl)phenyl]benzene
1-ethoxy-2,3-difluoro-4-[4-(4-propylcyclohexyl)phenyl]benzene (PubChem CID 18681376) has the molecular formula C23H28F2O
and a molecular weight of 358.47 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[4-(4-propylcyclohexyl)phenyl]benzene.
Molecular Properties
| Compound Name | 1-ethoxy-2,3-difluoro-4-[4-(4-propylcyclohexyl)phenyl]benzene |
| PubChem CID | 18681376 |
| Molecular Formula | C23H28F2O |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[4-(4-propylcyclohexyl)phenyl]benzene |
| SMILES | CCCC1CCC(c2ccc(-c3ccc(OCC)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C23H28F2O/c1-3-5-16-6-8-17(9-7-16)18-10-12-19(13-11-18)20-14-15-21(26-4-2)23(25)22(20)24/h10-17H,3-9H2,1-2H3 |
| InChIKey | IBFAIOMGVHPWRQ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethoxy-2,3-difluoro-4-[4-(4-propylcyclohexyl)phenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-2,3-difluoro-4-[4-(4-propylcyclohexyl)phenyl]benzene?
The IUPAC name of 1-ethoxy-2,3-difluoro-4-[4-(4-propylcyclohexyl)phenyl]benzene (CID 18681376) is 1-ethoxy-2,3-difluoro-4-[4-(4-propylcyclohexyl)phenyl]benzene.
What is the SMILES notation for 1-ethoxy-2,3-difluoro-4-[4-(4-propylcyclohexyl)phenyl]benzene?
The canonical SMILES for 1-ethoxy-2,3-difluoro-4-[4-(4-propylcyclohexyl)phenyl]benzene is CCCC1CCC(c2ccc(-c3ccc(OCC)c(F)c3F)cc2)CC1.
What is the InChIKey of 1-ethoxy-2,3-difluoro-4-[4-(4-propylcyclohexyl)phenyl]benzene?
The InChIKey is IBFAIOMGVHPWRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28F2O/c1-3-5-16-6-8-17(9-7-16)18-10-12-19(13-11-18)20-14-15-21(26-4-2)23(25)22(20)24/h10-17H,3-9H2,1-2H3.
What are the key properties of 1-ethoxy-2,3-difluoro-4-[4-(4-propylcyclohexyl)phenyl]benzene?
1-ethoxy-2,3-difluoro-4-[4-(4-propylcyclohexyl)phenyl]benzene has a molecular weight of 358.47 g/mol, XLogP of 7.10, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-2,3-difluoro-4-[4-(4-propylcyclohexyl)phenyl]benzene is sourced from PubChem (CID 18681376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).