About 1,1'-biphenyl;N-methylmethanamine
1,1'-biphenyl;N-methylmethanamine (PubChem CID 18681489) has the molecular formula C14H17N
and a molecular weight of 199.30 g/mol. Its IUPAC name is 1,1'-biphenyl;N-methylmethanamine.
Molecular Properties
| Compound Name | 1,1'-biphenyl;N-methylmethanamine |
| PubChem CID | 18681489 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 1,1'-biphenyl;N-methylmethanamine |
| SMILES | CNC.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C2H7N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h1-10H;3H,1-2H3 |
| InChIKey | QPYHQTNVOWBUSO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1'-biphenyl;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;N-methylmethanamine?
The IUPAC name of 1,1'-biphenyl;N-methylmethanamine (CID 18681489) is 1,1'-biphenyl;N-methylmethanamine.
What is the SMILES notation for 1,1'-biphenyl;N-methylmethanamine?
The canonical SMILES for 1,1'-biphenyl;N-methylmethanamine is CNC.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;N-methylmethanamine?
The InChIKey is QPYHQTNVOWBUSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C2H7N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h1-10H;3H,1-2H3.
What are the key properties of 1,1'-biphenyl;N-methylmethanamine?
1,1'-biphenyl;N-methylmethanamine has a molecular weight of 199.30 g/mol, XLogP of 3.19, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;N-methylmethanamine is sourced from PubChem (CID 18681489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).