C11H25NO2S — CID 18681650
N-(2,3,3,4,4-pentamethylpentan-2-yl)methanesulfonamide (PubChem CID 18681650) has the molecular formula C11H25NO2S and a molecular weight of 235.39 g/mol. Its IUPAC name is N-(2,3,3,4,4-pentamethylpentan-2-yl)methanesulfonamide.
| Compound Name | N-(2,3,3,4,4-pentamethylpentan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 18681650 |
| Molecular Formula | C11H25NO2S |
| Molecular Weight | 235.39 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N-(2,3,3,4,4-pentamethylpentan-2-yl)methanesulfonamide |
| SMILES | CC(C)(C)C(C)(C)C(C)(C)NS(C)(=O)=O |
| InChI | InChI=1S/C11H25NO2S/c1-9(2,3)10(4,5)11(6,7)12-15(8,13)14/h12H,1-8H3 |
| InChIKey | ZWPUWORQSMAZER-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |