About 3-amino-7-phenyl-1,5-dioxonane-6,9-dione
3-amino-7-phenyl-1,5-dioxonane-6,9-dione (PubChem CID 18681838) has the molecular formula C13H15NO4
and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-amino-7-phenyl-1,5-dioxonane-6,9-dione.
Molecular Properties
| Compound Name | 3-amino-7-phenyl-1,5-dioxonane-6,9-dione |
| PubChem CID | 18681838 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-amino-7-phenyl-1,5-dioxonane-6,9-dione |
| SMILES | NC1COC(=O)CC(c2ccccc2)C(=O)OC1 |
| InChI | InChI=1S/C13H15NO4/c14-10-7-17-12(15)6-11(13(16)18-8-10)9-4-2-1-3-5-9/h1-5,10-11H,6-8,14H2 |
| InChIKey | DMUAWMOSOMGMJN-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-7-phenyl-1,5-dioxonane-6,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-7-phenyl-1,5-dioxonane-6,9-dione?
The IUPAC name of 3-amino-7-phenyl-1,5-dioxonane-6,9-dione (CID 18681838) is 3-amino-7-phenyl-1,5-dioxonane-6,9-dione.
What is the SMILES notation for 3-amino-7-phenyl-1,5-dioxonane-6,9-dione?
The canonical SMILES for 3-amino-7-phenyl-1,5-dioxonane-6,9-dione is NC1COC(=O)CC(c2ccccc2)C(=O)OC1.
What is the InChIKey of 3-amino-7-phenyl-1,5-dioxonane-6,9-dione?
The InChIKey is DMUAWMOSOMGMJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4/c14-10-7-17-12(15)6-11(13(16)18-8-10)9-4-2-1-3-5-9/h1-5,10-11H,6-8,14H2.
What are the key properties of 3-amino-7-phenyl-1,5-dioxonane-6,9-dione?
3-amino-7-phenyl-1,5-dioxonane-6,9-dione has a molecular weight of 249.27 g/mol, XLogP of 0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-7-phenyl-1,5-dioxonane-6,9-dione is sourced from PubChem (CID 18681838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).