C10H15N3OS — CID 18682296
1-[2-(5-methyl-1,3-thiazol-2-yl)piperazin-1-yl]ethanone (PubChem CID 18682296) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is 1-[2-(5-methyl-1,3-thiazol-2-yl)piperazin-1-yl]ethanone.
| Compound Name | 1-[2-(5-methyl-1,3-thiazol-2-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 18682296 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 1-[2-(5-methyl-1,3-thiazol-2-yl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCNCC1c1ncc(C)s1 |
| InChI | InChI=1S/C10H15N3OS/c1-7-5-12-10(15-7)9-6-11-3-4-13(9)8(2)14/h5,9,11H,3-4,6H2,1-2H3 |
| InChIKey | PMJAGOUKSMBJPA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |