About 1-[2-(5-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]ethanone
1-[2-(5-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]ethanone (PubChem CID 18682297) has the molecular formula C10H14N2OS
and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-[2-(5-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[2-(5-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]ethanone |
| PubChem CID | 18682297 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-[2-(5-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC1c1ncc(C)s1 |
| InChI | InChI=1S/C10H14N2OS/c1-7-6-11-10(14-7)9-4-3-5-12(9)8(2)13/h6,9H,3-5H2,1-2H3 |
| InChIKey | RIQSEWNUJIHPOJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(5-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(5-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]ethanone?
The IUPAC name of 1-[2-(5-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]ethanone (CID 18682297) is 1-[2-(5-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]ethanone.
What is the SMILES notation for 1-[2-(5-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]ethanone?
The canonical SMILES for 1-[2-(5-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]ethanone is CC(=O)N1CCCC1c1ncc(C)s1.
What is the InChIKey of 1-[2-(5-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]ethanone?
The InChIKey is RIQSEWNUJIHPOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2OS/c1-7-6-11-10(14-7)9-4-3-5-12(9)8(2)13/h6,9H,3-5H2,1-2H3.
What are the key properties of 1-[2-(5-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]ethanone?
1-[2-(5-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]ethanone has a molecular weight of 210.30 g/mol, XLogP of 2.13, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(5-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]ethanone is sourced from PubChem (CID 18682297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).