About methyl 3-(3,3-dimethyl-2-oxopiperazin-1-yl)butanoate
methyl 3-(3,3-dimethyl-2-oxopiperazin-1-yl)butanoate (PubChem CID 18682367) has the molecular formula C11H20N2O3
and a molecular weight of 228.29 g/mol. Its IUPAC name is methyl 3-(3,3-dimethyl-2-oxopiperazin-1-yl)butanoate.
Molecular Properties
| Compound Name | methyl 3-(3,3-dimethyl-2-oxopiperazin-1-yl)butanoate |
| PubChem CID | 18682367 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | methyl 3-(3,3-dimethyl-2-oxopiperazin-1-yl)butanoate |
| SMILES | COC(=O)CC(C)N1CCNC(C)(C)C1=O |
| InChI | InChI=1S/C11H20N2O3/c1-8(7-9(14)16-4)13-6-5-12-11(2,3)10(13)15/h8,12H,5-7H2,1-4H3 |
| InChIKey | CUWQNNPEBAUWTJ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-(3,3-dimethyl-2-oxopiperazin-1-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3,3-dimethyl-2-oxopiperazin-1-yl)butanoate?
The IUPAC name of methyl 3-(3,3-dimethyl-2-oxopiperazin-1-yl)butanoate (CID 18682367) is methyl 3-(3,3-dimethyl-2-oxopiperazin-1-yl)butanoate.
What is the SMILES notation for methyl 3-(3,3-dimethyl-2-oxopiperazin-1-yl)butanoate?
The canonical SMILES for methyl 3-(3,3-dimethyl-2-oxopiperazin-1-yl)butanoate is COC(=O)CC(C)N1CCNC(C)(C)C1=O.
What is the InChIKey of methyl 3-(3,3-dimethyl-2-oxopiperazin-1-yl)butanoate?
The InChIKey is CUWQNNPEBAUWTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3/c1-8(7-9(14)16-4)13-6-5-12-11(2,3)10(13)15/h8,12H,5-7H2,1-4H3.
What are the key properties of methyl 3-(3,3-dimethyl-2-oxopiperazin-1-yl)butanoate?
methyl 3-(3,3-dimethyl-2-oxopiperazin-1-yl)butanoate has a molecular weight of 228.29 g/mol, XLogP of 0.15, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3,3-dimethyl-2-oxopiperazin-1-yl)butanoate is sourced from PubChem (CID 18682367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).