C19H17BrCl2N2O3 — CID 18682570
5-[(4-bromo-2-methoxyphenyl)methyl]-3-(3,5-dichlorophenyl)-1,5-dimethylimidazolidine-2,4-dione (PubChem CID 18682570) has the molecular formula C19H17BrCl2N2O3 and a molecular weight of 472.17 g/mol. Its IUPAC name is 5-[(4-bromo-2-methoxyphenyl)methyl]-3-(3,5-dichlorophenyl)-1,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 5-[(4-bromo-2-methoxyphenyl)methyl]-3-(3,5-dichlorophenyl)-1,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18682570 |
| Molecular Formula | C19H17BrCl2N2O3 |
| Molecular Weight | 472.17 g/mol |
| Exact Mass | 469.98 |
| IUPAC Name | 5-[(4-bromo-2-methoxyphenyl)methyl]-3-(3,5-dichlorophenyl)-1,5-dimethylimidazolidine-2,4-dione |
| SMILES | COc1cc(Br)ccc1CC1(C)C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)N1C |
| InChI | InChI=1S/C19H17BrCl2N2O3/c1-19(10-11-4-5-12(20)6-16(11)27-3)17(25)24(18(26)23(19)2)15-8-13(21)7-14(22)9-15/h4-9H,10H2,1-3H3 |
| InChIKey | ODFDWWVLJPSJQT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.17 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|