C11H18O2 — CID 18682713
3'-methylspiro[1,3-dioxolane-2,6'-2,3,3a,4,5,6a-hexahydro-1H-pentalene] (PubChem CID 18682713) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 3'-methylspiro[1,3-dioxolane-2,6'-2,3,3a,4,5,6a-hexahydro-1H-pentalene].
| Compound Name | 3'-methylspiro[1,3-dioxolane-2,6'-2,3,3a,4,5,6a-hexahydro-1H-pentalene] |
|---|---|
| PubChem CID | 18682713 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 3'-methylspiro[1,3-dioxolane-2,6'-2,3,3a,4,5,6a-hexahydro-1H-pentalene] |
| SMILES | CC1CCC2C1CCC21OCCO1 |
| InChI | InChI=1S/C11H18O2/c1-8-2-3-10-9(8)4-5-11(10)12-6-7-13-11/h8-10H,2-7H2,1H3 |
| InChIKey | CEDOYUMIQDPHDU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |