About dichloromolybdenum;bis(methyl(pyridin-2-ylmethyl)oxidanium)
dichloromolybdenum;bis(methyl(pyridin-2-ylmethyl)oxidanium) (PubChem CID 18683165) has the molecular formula C14H20Cl2MoN2O2+2
and a molecular weight of 415.17 g/mol. Its IUPAC name is dichloromolybdenum;bis(methyl(pyridin-2-ylmethyl)oxidanium).
Molecular Properties
| Compound Name | dichloromolybdenum;bis(methyl(pyridin-2-ylmethyl)oxidanium) |
| PubChem CID | 18683165 |
| Molecular Formula | C14H20Cl2MoN2O2+2 |
| Molecular Weight | 415.17 g/mol |
| Exact Mass | 415.99 |
| IUPAC Name | dichloromolybdenum;bis(methyl(pyridin-2-ylmethyl)oxidanium) |
| SMILES | C[OH+]Cc1ccccn1.C[OH+]Cc1ccccn1.Cl[Mo]Cl |
| InChI | InChI=1S/2C7H9NO.2ClH.Mo/c2*1-9-6-7-4-2-3-5-8-7;;;/h2*2-5H,6H2,1H3;2*1H;/q;;;;+2 |
| InChIKey | ZBRQLFUKNQEFRG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 51.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.17 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze dichloromolybdenum;bis(methyl(pyridin-2-ylmethyl)oxidanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromolybdenum;bis(methyl(pyridin-2-ylmethyl)oxidanium)?
The IUPAC name of dichloromolybdenum;bis(methyl(pyridin-2-ylmethyl)oxidanium) (CID 18683165) is dichloromolybdenum;bis(methyl(pyridin-2-ylmethyl)oxidanium).
What is the SMILES notation for dichloromolybdenum;bis(methyl(pyridin-2-ylmethyl)oxidanium)?
The canonical SMILES for dichloromolybdenum;bis(methyl(pyridin-2-ylmethyl)oxidanium) is C[OH+]Cc1ccccn1.C[OH+]Cc1ccccn1.Cl[Mo]Cl.
What is the InChIKey of dichloromolybdenum;bis(methyl(pyridin-2-ylmethyl)oxidanium)?
The InChIKey is ZBRQLFUKNQEFRG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H9NO.2ClH.Mo/c2*1-9-6-7-4-2-3-5-8-7;;;/h2*2-5H,6H2,1H3;2*1H;/q;;;;+2.
What are the key properties of dichloromolybdenum;bis(methyl(pyridin-2-ylmethyl)oxidanium)?
dichloromolybdenum;bis(methyl(pyridin-2-ylmethyl)oxidanium) has a molecular weight of 415.17 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromolybdenum;bis(methyl(pyridin-2-ylmethyl)oxidanium) is sourced from PubChem (CID 18683165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).