C20H18 — CID 18683184
1-methyl-4-(4-methylphenyl)-2-phenylbenzene (PubChem CID 18683184) has the molecular formula C20H18 and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-methyl-4-(4-methylphenyl)-2-phenylbenzene.
| Compound Name | 1-methyl-4-(4-methylphenyl)-2-phenylbenzene |
|---|---|
| PubChem CID | 18683184 |
| Molecular Formula | C20H18 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 1-methyl-4-(4-methylphenyl)-2-phenylbenzene |
| SMILES | Cc1ccc(-c2ccc(C)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C20H18/c1-15-8-11-17(12-9-15)19-13-10-16(2)20(14-19)18-6-4-3-5-7-18/h3-14H,1-2H3 |
| InChIKey | JMOIZWXQPCVZAE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |