About 7-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine
7-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine (PubChem CID 18683333) has the molecular formula C6H10N4
and a molecular weight of 138.17 g/mol. Its IUPAC name is 7-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine.
Analyze 7-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine?
The IUPAC name of 7-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine (CID 18683333) is 7-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine.
What is the SMILES notation for 7-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine?
The canonical SMILES for 7-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine is CN1CCn2ncnc2C1.
What is the InChIKey of 7-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine?
The InChIKey is JXSVAZTXBFQZDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4/c1-9-2-3-10-6(4-9)7-5-8-10/h5H,2-4H2,1H3.
What are the key properties of 7-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine?
7-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine has a molecular weight of 138.17 g/mol, XLogP of -0.28, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine is sourced from PubChem (CID 18683333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).