About 1-ethyl-2,3,4,5-tetramethylpyrrole
1-ethyl-2,3,4,5-tetramethylpyrrole (PubChem CID 18683533) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 1-ethyl-2,3,4,5-tetramethylpyrrole.
Molecular Properties
| Compound Name | 1-ethyl-2,3,4,5-tetramethylpyrrole |
| PubChem CID | 18683533 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 1-ethyl-2,3,4,5-tetramethylpyrrole |
| SMILES | CCn1c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C10H17N/c1-6-11-9(4)7(2)8(3)10(11)5/h6H2,1-5H3 |
| InChIKey | CWNBRZJSVJDHJX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyl-2,3,4,5-tetramethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,3,4,5-tetramethylpyrrole?
The IUPAC name of 1-ethyl-2,3,4,5-tetramethylpyrrole (CID 18683533) is 1-ethyl-2,3,4,5-tetramethylpyrrole.
What is the SMILES notation for 1-ethyl-2,3,4,5-tetramethylpyrrole?
The canonical SMILES for 1-ethyl-2,3,4,5-tetramethylpyrrole is CCn1c(C)c(C)c(C)c1C.
What is the InChIKey of 1-ethyl-2,3,4,5-tetramethylpyrrole?
The InChIKey is CWNBRZJSVJDHJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-6-11-9(4)7(2)8(3)10(11)5/h6H2,1-5H3.
What are the key properties of 1-ethyl-2,3,4,5-tetramethylpyrrole?
1-ethyl-2,3,4,5-tetramethylpyrrole has a molecular weight of 151.25 g/mol, XLogP of 2.74, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,3,4,5-tetramethylpyrrole is sourced from PubChem (CID 18683533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).