C13H20F5NO2 — CID 18684107
N-(2-ethoxyethyl)-N-ethyl-1,2,2,6,6-pentafluorocyclohexane-1-carboxamide (PubChem CID 18684107) has the molecular formula C13H20F5NO2 and a molecular weight of 317.30 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-N-ethyl-1,2,2,6,6-pentafluorocyclohexane-1-carboxamide.
| Compound Name | N-(2-ethoxyethyl)-N-ethyl-1,2,2,6,6-pentafluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 18684107 |
| Molecular Formula | C13H20F5NO2 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-(2-ethoxyethyl)-N-ethyl-1,2,2,6,6-pentafluorocyclohexane-1-carboxamide |
| SMILES | CCOCCN(CC)C(=O)C1(F)C(F)(F)CCCC1(F)F |
| InChI | InChI=1S/C13H20F5NO2/c1-3-19(8-9-21-4-2)10(20)13(18)11(14,15)6-5-7-12(13,16)17/h3-9H2,1-2H3 |
| InChIKey | HWNSJOIBJGLGID-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|