C25H29NO3 — CID 18684288
6-(3',3',6-trimethylspiro[chromene-2,2'-indole]-1'-yl)hexanoic acid (PubChem CID 18684288) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is 6-(3',3',6-trimethylspiro[chromene-2,2'-indole]-1'-yl)hexanoic acid.
| Compound Name | 6-(3',3',6-trimethylspiro[chromene-2,2'-indole]-1'-yl)hexanoic acid |
|---|---|
| PubChem CID | 18684288 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 6-(3',3',6-trimethylspiro[chromene-2,2'-indole]-1'-yl)hexanoic acid |
| SMILES | Cc1ccc2c(c1)C=CC1(O2)N(CCCCCC(=O)O)c2ccccc2C1(C)C |
| InChI | InChI=1S/C25H29NO3/c1-18-12-13-22-19(17-18)14-15-25(29-22)24(2,3)20-9-6-7-10-21(20)26(25)16-8-4-5-11-23(27)28/h6-7,9-10,12-15,17H,4-5,8,11,16H2,1-3H3,(H,27,28) |
| InChIKey | HPVATMQXUIELHZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|