About bis(ethoxymethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate
bis(ethoxymethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 18684325) has the molecular formula C15H22O6
and a molecular weight of 298.34 g/mol. Its IUPAC name is bis(ethoxymethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
Molecular Properties
| Compound Name | bis(ethoxymethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| PubChem CID | 18684325 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | bis(ethoxymethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CCOCOC(=O)C1C2C=CC(C2)C1C(=O)OCOCC |
| InChI | InChI=1S/C15H22O6/c1-3-18-8-20-14(16)12-10-5-6-11(7-10)13(12)15(17)21-9-19-4-2/h5-6,10-13H,3-4,7-9H2,1-2H3 |
| InChIKey | YCDDARWPZYLXTI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(ethoxymethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(ethoxymethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
The IUPAC name of bis(ethoxymethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (CID 18684325) is bis(ethoxymethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
What is the SMILES notation for bis(ethoxymethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
The canonical SMILES for bis(ethoxymethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate is CCOCOC(=O)C1C2C=CC(C2)C1C(=O)OCOCC.
What is the InChIKey of bis(ethoxymethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
The InChIKey is YCDDARWPZYLXTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O6/c1-3-18-8-20-14(16)12-10-5-6-11(7-10)13(12)15(17)21-9-19-4-2/h5-6,10-13H,3-4,7-9H2,1-2H3.
What are the key properties of bis(ethoxymethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
bis(ethoxymethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate has a molecular weight of 298.34 g/mol, XLogP of 1.50, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(ethoxymethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate is sourced from PubChem (CID 18684325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).