About 2-O-(2-bicyclo[2.2.1]heptanylmethyl) 3-O-(methoxymethyl) bicyclo[2.2.1]heptane-2,3-dicarboxylate
2-O-(2-bicyclo[2.2.1]heptanylmethyl) 3-O-(methoxymethyl) bicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 18684333) has the molecular formula C19H28O5
and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-O-(2-bicyclo[2.2.1]heptanylmethyl) 3-O-(methoxymethyl) bicyclo[2.2.1]heptane-2,3-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-(2-bicyclo[2.2.1]heptanylmethyl) 3-O-(methoxymethyl) bicyclo[2.2.1]heptane-2,3-dicarboxylate |
| PubChem CID | 18684333 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 2-O-(2-bicyclo[2.2.1]heptanylmethyl) 3-O-(methoxymethyl) bicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | COCOC(=O)C1C2CCC(C2)C1C(=O)OCC1CC2CCC1C2 |
| InChI | InChI=1S/C19H28O5/c1-22-10-24-19(21)17-14-5-4-13(8-14)16(17)18(20)23-9-15-7-11-2-3-12(15)6-11/h11-17H,2-10H2,1H3 |
| InChIKey | CXAJJIZPKTXSGM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-O-(2-bicyclo[2.2.1]heptanylmethyl) 3-O-(methoxymethyl) bicyclo[2.2.1]heptane-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-(2-bicyclo[2.2.1]heptanylmethyl) 3-O-(methoxymethyl) bicyclo[2.2.1]heptane-2,3-dicarboxylate?
The IUPAC name of 2-O-(2-bicyclo[2.2.1]heptanylmethyl) 3-O-(methoxymethyl) bicyclo[2.2.1]heptane-2,3-dicarboxylate (CID 18684333) is 2-O-(2-bicyclo[2.2.1]heptanylmethyl) 3-O-(methoxymethyl) bicyclo[2.2.1]heptane-2,3-dicarboxylate.
What is the SMILES notation for 2-O-(2-bicyclo[2.2.1]heptanylmethyl) 3-O-(methoxymethyl) bicyclo[2.2.1]heptane-2,3-dicarboxylate?
The canonical SMILES for 2-O-(2-bicyclo[2.2.1]heptanylmethyl) 3-O-(methoxymethyl) bicyclo[2.2.1]heptane-2,3-dicarboxylate is COCOC(=O)C1C2CCC(C2)C1C(=O)OCC1CC2CCC1C2.
What is the InChIKey of 2-O-(2-bicyclo[2.2.1]heptanylmethyl) 3-O-(methoxymethyl) bicyclo[2.2.1]heptane-2,3-dicarboxylate?
The InChIKey is CXAJJIZPKTXSGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O5/c1-22-10-24-19(21)17-14-5-4-13(8-14)16(17)18(20)23-9-15-7-11-2-3-12(15)6-11/h11-17H,2-10H2,1H3.
What are the key properties of 2-O-(2-bicyclo[2.2.1]heptanylmethyl) 3-O-(methoxymethyl) bicyclo[2.2.1]heptane-2,3-dicarboxylate?
2-O-(2-bicyclo[2.2.1]heptanylmethyl) 3-O-(methoxymethyl) bicyclo[2.2.1]heptane-2,3-dicarboxylate has a molecular weight of 336.43 g/mol, XLogP of 2.78, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-(2-bicyclo[2.2.1]heptanylmethyl) 3-O-(methoxymethyl) bicyclo[2.2.1]heptane-2,3-dicarboxylate is sourced from PubChem (CID 18684333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).