C14H38O4Si4 — CID 18684360
2-methyl-4-tris(trimethylsilyloxy)silylbutan-2-ol (PubChem CID 18684360) has the molecular formula C14H38O4Si4 and a molecular weight of 382.80 g/mol. Its IUPAC name is 2-methyl-4-tris(trimethylsilyloxy)silylbutan-2-ol.
| Compound Name | 2-methyl-4-tris(trimethylsilyloxy)silylbutan-2-ol |
|---|---|
| PubChem CID | 18684360 |
| Molecular Formula | C14H38O4Si4 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 2-methyl-4-tris(trimethylsilyloxy)silylbutan-2-ol |
| SMILES | CC(C)(O)CC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H38O4Si4/c1-14(2,15)12-13-22(16-19(3,4)5,17-20(6,7)8)18-21(9,10)11/h15H,12-13H2,1-11H3 |
| InChIKey | YJJYTXSKDSUUBW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|