C23H36N2O — CID 18684530
1,1',3',3',4,4',4',5,5',5',6,7-dodecamethylspiro[indole-3,2'-pyrrolidine]-2-one (PubChem CID 18684530) has the molecular formula C23H36N2O and a molecular weight of 356.55 g/mol. Its IUPAC name is 1,1',3',3',4,4',4',5,5',5',6,7-dodecamethylspiro[indole-3,2'-pyrrolidine]-2-one.
| Compound Name | 1,1',3',3',4,4',4',5,5',5',6,7-dodecamethylspiro[indole-3,2'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 18684530 |
| Molecular Formula | C23H36N2O |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.28 |
| IUPAC Name | 1,1',3',3',4,4',4',5,5',5',6,7-dodecamethylspiro[indole-3,2'-pyrrolidine]-2-one |
| SMILES | Cc1c(C)c(C)c2c(c1C)N(C)C(=O)C21N(C)C(C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C23H36N2O/c1-13-14(2)16(4)18-17(15(13)3)23(19(26)24(18)11)21(7,8)20(5,6)22(9,10)25(23)12/h1-12H3 |
| InChIKey | BYWDVPOYALAUJQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |