C13H23N — CID 18684732
2,3-dimethyl-2,3a,4,4a,5,6,7,8,8a,8b-decahydro-1H-indeno[2,1-b]pyrrole (PubChem CID 18684732) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 2,3-dimethyl-2,3a,4,4a,5,6,7,8,8a,8b-decahydro-1H-indeno[2,1-b]pyrrole.
| Compound Name | 2,3-dimethyl-2,3a,4,4a,5,6,7,8,8a,8b-decahydro-1H-indeno[2,1-b]pyrrole |
|---|---|
| PubChem CID | 18684732 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 2,3-dimethyl-2,3a,4,4a,5,6,7,8,8a,8b-decahydro-1H-indeno[2,1-b]pyrrole |
| SMILES | CC1CC2C3CCCCC3CC2N1C |
| InChI | InChI=1S/C13H23N/c1-9-7-12-11-6-4-3-5-10(11)8-13(12)14(9)2/h9-13H,3-8H2,1-2H3 |
| InChIKey | XFCQOTBNGLKUBZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |