C24H31N3O4 — CID 18684866
5-(aminomethyl)-3-[4-[1-(benzylperoxymethyl)-3-methylazetidin-3-yl]-3,5-dimethylphenyl]-1,3-oxazolidin-2-one (PubChem CID 18684866) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 5-(aminomethyl)-3-[4-[1-(benzylperoxymethyl)-3-methylazetidin-3-yl]-3,5-dimethylphenyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-(aminomethyl)-3-[4-[1-(benzylperoxymethyl)-3-methylazetidin-3-yl]-3,5-dimethylphenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 18684866 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 5-(aminomethyl)-3-[4-[1-(benzylperoxymethyl)-3-methylazetidin-3-yl]-3,5-dimethylphenyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1cc(N2CC(CN)OC2=O)cc(C)c1C1(C)CN(COOCc2ccccc2)C1 |
| InChI | InChI=1S/C24H31N3O4/c1-17-9-20(27-12-21(11-25)31-23(27)28)10-18(2)22(17)24(3)14-26(15-24)16-30-29-13-19-7-5-4-6-8-19/h4-10,21H,11-16,25H2,1-3H3 |
| InChIKey | AUTPIAUUTWKJRI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|