C13H17NaO3 — CID 18684898
sodium 2-(5-tert-butyl-2-methoxyphenyl)acetate (PubChem CID 18684898) has the molecular formula C13H17NaO3 and a molecular weight of 244.27 g/mol. Its IUPAC name is sodium 2-(5-tert-butyl-2-methoxyphenyl)acetate.
| Compound Name | sodium 2-(5-tert-butyl-2-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 18684898 |
| Molecular Formula | C13H17NaO3 |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | sodium 2-(5-tert-butyl-2-methoxyphenyl)acetate |
| SMILES | COc1ccc(C(C)(C)C)cc1CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C13H18O3.Na/c1-13(2,3)10-5-6-11(16-4)9(7-10)8-12(14)15;/h5-7H,8H2,1-4H3,(H,14,15);/q;+1/p-1 |
| InChIKey | WJVWXKXMCRXOKL-UHFFFAOYSA-M |
| XLogP | -1.71 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |