About (E)-N-(2,4-dimethyl-1,3-thiazol-5-yl)ethanimine
(E)-N-(2,4-dimethyl-1,3-thiazol-5-yl)ethanimine (PubChem CID 18684923) has the molecular formula C7H10N2S
and a molecular weight of 154.24 g/mol. Its IUPAC name is (E)-N-(2,4-dimethyl-1,3-thiazol-5-yl)ethanimine.
Molecular Properties
| Compound Name | (E)-N-(2,4-dimethyl-1,3-thiazol-5-yl)ethanimine |
| PubChem CID | 18684923 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (E)-N-(2,4-dimethyl-1,3-thiazol-5-yl)ethanimine |
| SMILES | C/C=N/c1sc(C)nc1C |
| InChI | InChI=1S/C7H10N2S/c1-4-8-7-5(2)9-6(3)10-7/h4H,1-3H3/b8-4+ |
| InChIKey | UVOPERGURRNWMP-XBXARRHUSA-N |
| XLogP | 2.48 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(2,4-dimethyl-1,3-thiazol-5-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(2,4-dimethyl-1,3-thiazol-5-yl)ethanimine?
The IUPAC name of (E)-N-(2,4-dimethyl-1,3-thiazol-5-yl)ethanimine (CID 18684923) is (E)-N-(2,4-dimethyl-1,3-thiazol-5-yl)ethanimine.
What is the SMILES notation for (E)-N-(2,4-dimethyl-1,3-thiazol-5-yl)ethanimine?
The canonical SMILES for (E)-N-(2,4-dimethyl-1,3-thiazol-5-yl)ethanimine is C/C=N/c1sc(C)nc1C.
What is the InChIKey of (E)-N-(2,4-dimethyl-1,3-thiazol-5-yl)ethanimine?
The InChIKey is UVOPERGURRNWMP-XBXARRHUSA-N. The full InChI is InChI=1S/C7H10N2S/c1-4-8-7-5(2)9-6(3)10-7/h4H,1-3H3/b8-4+.
What are the key properties of (E)-N-(2,4-dimethyl-1,3-thiazol-5-yl)ethanimine?
(E)-N-(2,4-dimethyl-1,3-thiazol-5-yl)ethanimine has a molecular weight of 154.24 g/mol, XLogP of 2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(2,4-dimethyl-1,3-thiazol-5-yl)ethanimine is sourced from PubChem (CID 18684923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).