C25H29N3O2S — CID 18684930
tert-butyl N-[4-[6-(thian-4-ylamino)-3-pyridinyl]naphthalen-1-yl]carbamate (PubChem CID 18684930) has the molecular formula C25H29N3O2S and a molecular weight of 435.59 g/mol. Its IUPAC name is tert-butyl N-[4-[6-(thian-4-ylamino)-3-pyridinyl]naphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[4-[6-(thian-4-ylamino)-3-pyridinyl]naphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 18684930 |
| Molecular Formula | C25H29N3O2S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | tert-butyl N-[4-[6-(thian-4-ylamino)-3-pyridinyl]naphthalen-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-c2ccc(NC3CCSCC3)nc2)c2ccccc12 |
| InChI | InChI=1S/C25H29N3O2S/c1-25(2,3)30-24(29)28-22-10-9-19(20-6-4-5-7-21(20)22)17-8-11-23(26-16-17)27-18-12-14-31-15-13-18/h4-11,16,18H,12-15H2,1-3H3,(H,26,27)(H,28,29) |
| InChIKey | HWLJDAJCEUYZHC-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |