About 3,5,7-trimethylpyrazolo[1,5-a]pyrimidine
3,5,7-trimethylpyrazolo[1,5-a]pyrimidine (PubChem CID 18684975) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 3,5,7-trimethylpyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 3,5,7-trimethylpyrazolo[1,5-a]pyrimidine |
| PubChem CID | 18684975 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 3,5,7-trimethylpyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc(C)n2ncc(C)c2n1 |
| InChI | InChI=1S/C9H11N3/c1-6-5-10-12-8(3)4-7(2)11-9(6)12/h4-5H,1-3H3 |
| InChIKey | SBRLSFLXAOFBDJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5,7-trimethylpyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,7-trimethylpyrazolo[1,5-a]pyrimidine?
The IUPAC name of 3,5,7-trimethylpyrazolo[1,5-a]pyrimidine (CID 18684975) is 3,5,7-trimethylpyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 3,5,7-trimethylpyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 3,5,7-trimethylpyrazolo[1,5-a]pyrimidine is Cc1cc(C)n2ncc(C)c2n1.
What is the InChIKey of 3,5,7-trimethylpyrazolo[1,5-a]pyrimidine?
The InChIKey is SBRLSFLXAOFBDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c1-6-5-10-12-8(3)4-7(2)11-9(6)12/h4-5H,1-3H3.
What are the key properties of 3,5,7-trimethylpyrazolo[1,5-a]pyrimidine?
3,5,7-trimethylpyrazolo[1,5-a]pyrimidine has a molecular weight of 161.21 g/mol, XLogP of 1.65, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,7-trimethylpyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 18684975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).