C11H21N3O — CID 18684996
1,3,7,8a-tetramethyl-4a,5,6,8-tetrahydro-4H-pyrido[3,4-d]pyrimidin-2-one (PubChem CID 18684996) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 1,3,7,8a-tetramethyl-4a,5,6,8-tetrahydro-4H-pyrido[3,4-d]pyrimidin-2-one.
| Compound Name | 1,3,7,8a-tetramethyl-4a,5,6,8-tetrahydro-4H-pyrido[3,4-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 18684996 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1,3,7,8a-tetramethyl-4a,5,6,8-tetrahydro-4H-pyrido[3,4-d]pyrimidin-2-one |
| SMILES | CN1CCC2CN(C)C(=O)N(C)C2(C)C1 |
| InChI | InChI=1S/C11H21N3O/c1-11-8-12(2)6-5-9(11)7-13(3)10(15)14(11)4/h9H,5-8H2,1-4H3 |
| InChIKey | QANVPVYHQQYZSM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |