C9H16N2O — CID 18685036
1,3a-dimethyl-3,4,5,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one (PubChem CID 18685036) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 1,3a-dimethyl-3,4,5,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one.
| Compound Name | 1,3a-dimethyl-3,4,5,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 18685036 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 1,3a-dimethyl-3,4,5,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one |
| SMILES | CN1C(=O)CC2(C)CNCCC12 |
| InChI | InChI=1S/C9H16N2O/c1-9-5-8(12)11(2)7(9)3-4-10-6-9/h7,10H,3-6H2,1-2H3 |
| InChIKey | AGQISVLDTZSTJM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |