C9H14N2O2 — CID 18685046
2,3a-dimethyl-5,6,7,7a-tetrahydro-4H-pyrrolo[3,4-c]pyridine-1,3-dione (PubChem CID 18685046) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2,3a-dimethyl-5,6,7,7a-tetrahydro-4H-pyrrolo[3,4-c]pyridine-1,3-dione.
| Compound Name | 2,3a-dimethyl-5,6,7,7a-tetrahydro-4H-pyrrolo[3,4-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 18685046 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2,3a-dimethyl-5,6,7,7a-tetrahydro-4H-pyrrolo[3,4-c]pyridine-1,3-dione |
| SMILES | CN1C(=O)C2CCNCC2(C)C1=O |
| InChI | InChI=1S/C9H14N2O2/c1-9-5-10-4-3-6(9)7(12)11(2)8(9)13/h6,10H,3-5H2,1-2H3 |
| InChIKey | UMGNHNWYEUAACY-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|