About 3a-methyl-3,4,5,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine
3a-methyl-3,4,5,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine (PubChem CID 18685062) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is 3a-methyl-3,4,5,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine.
Analyze 3a-methyl-3,4,5,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a-methyl-3,4,5,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine?
The IUPAC name of 3a-methyl-3,4,5,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine (CID 18685062) is 3a-methyl-3,4,5,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine.
What is the SMILES notation for 3a-methyl-3,4,5,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine?
The canonical SMILES for 3a-methyl-3,4,5,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine is CC12CNCCC1COC2.
What is the InChIKey of 3a-methyl-3,4,5,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine?
The InChIKey is JNTBMMFGXLXSLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-8-5-9-3-2-7(8)4-10-6-8/h7,9H,2-6H2,1H3.
What are the key properties of 3a-methyl-3,4,5,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine?
3a-methyl-3,4,5,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine has a molecular weight of 141.21 g/mol, XLogP of 0.63, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3a-methyl-3,4,5,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine is sourced from PubChem (CID 18685062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).