About 3-(aminomethyl)-1,3-dimethylpiperidin-4-ol
3-(aminomethyl)-1,3-dimethylpiperidin-4-ol (PubChem CID 18685094) has the molecular formula C8H18N2O
and a molecular weight of 158.24 g/mol. Its IUPAC name is 3-(aminomethyl)-1,3-dimethylpiperidin-4-ol.
Molecular Properties
| Compound Name | 3-(aminomethyl)-1,3-dimethylpiperidin-4-ol |
| PubChem CID | 18685094 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 3-(aminomethyl)-1,3-dimethylpiperidin-4-ol |
| SMILES | CN1CCC(O)C(C)(CN)C1 |
| InChI | InChI=1S/C8H18N2O/c1-8(5-9)6-10(2)4-3-7(8)11/h7,11H,3-6,9H2,1-2H3 |
| InChIKey | UQVGIKBFJMLKSS-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(aminomethyl)-1,3-dimethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-1,3-dimethylpiperidin-4-ol?
The IUPAC name of 3-(aminomethyl)-1,3-dimethylpiperidin-4-ol (CID 18685094) is 3-(aminomethyl)-1,3-dimethylpiperidin-4-ol.
What is the SMILES notation for 3-(aminomethyl)-1,3-dimethylpiperidin-4-ol?
The canonical SMILES for 3-(aminomethyl)-1,3-dimethylpiperidin-4-ol is CN1CCC(O)C(C)(CN)C1.
What is the InChIKey of 3-(aminomethyl)-1,3-dimethylpiperidin-4-ol?
The InChIKey is UQVGIKBFJMLKSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O/c1-8(5-9)6-10(2)4-3-7(8)11/h7,11H,3-6,9H2,1-2H3.
What are the key properties of 3-(aminomethyl)-1,3-dimethylpiperidin-4-ol?
3-(aminomethyl)-1,3-dimethylpiperidin-4-ol has a molecular weight of 158.24 g/mol, XLogP of -0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-1,3-dimethylpiperidin-4-ol is sourced from PubChem (CID 18685094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).