About 5-(2-aminoethyl)-2,4-dimethyl-1H-pyrazol-3-one
5-(2-aminoethyl)-2,4-dimethyl-1H-pyrazol-3-one (PubChem CID 18685141) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is 5-(2-aminoethyl)-2,4-dimethyl-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | 5-(2-aminoethyl)-2,4-dimethyl-1H-pyrazol-3-one |
| PubChem CID | 18685141 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 5-(2-aminoethyl)-2,4-dimethyl-1H-pyrazol-3-one |
| SMILES | Cc1c(CCN)[nH]n(C)c1=O |
| InChI | InChI=1S/C7H13N3O/c1-5-6(3-4-8)9-10(2)7(5)11/h9H,3-4,8H2,1-2H3 |
| InChIKey | BKEXSIJVHROOPC-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 63.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2-aminoethyl)-2,4-dimethyl-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-aminoethyl)-2,4-dimethyl-1H-pyrazol-3-one?
The IUPAC name of 5-(2-aminoethyl)-2,4-dimethyl-1H-pyrazol-3-one (CID 18685141) is 5-(2-aminoethyl)-2,4-dimethyl-1H-pyrazol-3-one.
What is the SMILES notation for 5-(2-aminoethyl)-2,4-dimethyl-1H-pyrazol-3-one?
The canonical SMILES for 5-(2-aminoethyl)-2,4-dimethyl-1H-pyrazol-3-one is Cc1c(CCN)[nH]n(C)c1=O.
What is the InChIKey of 5-(2-aminoethyl)-2,4-dimethyl-1H-pyrazol-3-one?
The InChIKey is BKEXSIJVHROOPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O/c1-5-6(3-4-8)9-10(2)7(5)11/h9H,3-4,8H2,1-2H3.
What are the key properties of 5-(2-aminoethyl)-2,4-dimethyl-1H-pyrazol-3-one?
5-(2-aminoethyl)-2,4-dimethyl-1H-pyrazol-3-one has a molecular weight of 155.20 g/mol, XLogP of -0.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-aminoethyl)-2,4-dimethyl-1H-pyrazol-3-one is sourced from PubChem (CID 18685141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).