C17H24N4 — CID 18685205
1-[(3-benzyl-2-methylimidazol-4-yl)methyl]-4-methylpiperazine (PubChem CID 18685205) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 1-[(3-benzyl-2-methylimidazol-4-yl)methyl]-4-methylpiperazine.
| Compound Name | 1-[(3-benzyl-2-methylimidazol-4-yl)methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 18685205 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 1-[(3-benzyl-2-methylimidazol-4-yl)methyl]-4-methylpiperazine |
| SMILES | Cc1ncc(CN2CCN(C)CC2)n1Cc1ccccc1 |
| InChI | InChI=1S/C17H24N4/c1-15-18-12-17(14-20-10-8-19(2)9-11-20)21(15)13-16-6-4-3-5-7-16/h3-7,12H,8-11,13-14H2,1-2H3 |
| InChIKey | XIBOSJUEDSFCQY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |