C31H37N5O6 — CID 18685254
2-[6-butoxy-2-[(4-carbamimidoylphenyl)carbamoyl]-3-pyridinyl]-5-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]carbamoyl]benzoic acid (PubChem CID 18685254) has the molecular formula C31H37N5O6 and a molecular weight of 575.67 g/mol. Its IUPAC name is 2-[6-butoxy-2-[(4-carbamimidoylphenyl)carbamoyl]-3-pyridinyl]-5-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]carbamoyl]benzoic acid.
| Compound Name | 2-[6-butoxy-2-[(4-carbamimidoylphenyl)carbamoyl]-3-pyridinyl]-5-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18685254 |
| Molecular Formula | C31H37N5O6 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | 2-[6-butoxy-2-[(4-carbamimidoylphenyl)carbamoyl]-3-pyridinyl]-5-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]carbamoyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2nc(OCCCC)ccc2-c2ccc(C(=O)N[C@H](CO)C(C)(C)C)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C31H37N5O6/c1-5-6-15-42-25-14-13-22(26(36-25)29(39)34-20-10-7-18(8-11-20)27(32)33)21-12-9-19(16-23(21)30(40)41)28(38)35-24(17-37)31(2,3)4/h7-14,16,24,37H,5-6,15,17H2,1-4H3,(H3,32,33)(H,34,39)(H,35,38)(H,40,41)/t24-/m1/s1 |
| InChIKey | GQLDTLLTOUSHGV-XMMPIXPASA-N |
| XLogP | 4.30 |
| TPSA | 187.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|