C30H34N6O7 — CID 18685300
2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]-5-[[(2S)-1-(2-hydroxyethylamino)-4-methyl-1-oxopentan-2-yl]carbamoyl]benzoic acid (PubChem CID 18685300) has the molecular formula C30H34N6O7 and a molecular weight of 590.64 g/mol. Its IUPAC name is 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]-5-[[(2S)-1-(2-hydroxyethylamino)-4-methyl-1-oxopentan-2-yl]carbamoyl]benzoic acid.
| Compound Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]-5-[[(2S)-1-(2-hydroxyethylamino)-4-methyl-1-oxopentan-2-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18685300 |
| Molecular Formula | C30H34N6O7 |
| Molecular Weight | 590.64 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]-5-[[(2S)-1-(2-hydroxyethylamino)-4-methyl-1-oxopentan-2-yl]carbamoyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2nc(OC)ccc2-c2ccc(C(=O)N[C@@H](CC(C)C)C(=O)NCCO)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C30H34N6O7/c1-16(2)14-23(28(39)33-12-13-37)35-27(38)18-6-9-20(22(15-18)30(41)42)21-10-11-24(43-3)36-25(21)29(40)34-19-7-4-17(5-8-19)26(31)32/h4-11,15-16,23,37H,12-14H2,1-3H3,(H3,31,32)(H,33,39)(H,34,40)(H,35,38)(H,41,42)/t23-/m0/s1 |
| InChIKey | ARASRXFKMTZTFE-QHCPKHFHSA-N |
| XLogP | 2.24 |
| TPSA | 216.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.64 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|