C29H33N5O6 — CID 18685301
2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]-5-[[(2S)-1-hydroxy-4-methylpentan-2-yl]carbamoyl]-4-methylbenzoic acid (PubChem CID 18685301) has the molecular formula C29H33N5O6 and a molecular weight of 547.61 g/mol. Its IUPAC name is 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]-5-[[(2S)-1-hydroxy-4-methylpentan-2-yl]carbamoyl]-4-methylbenzoic acid.
| Compound Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]-5-[[(2S)-1-hydroxy-4-methylpentan-2-yl]carbamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 18685301 |
| Molecular Formula | C29H33N5O6 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]-5-[[(2S)-1-hydroxy-4-methylpentan-2-yl]carbamoyl]-4-methylbenzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2nc(OC)ccc2-c2cc(C)c(C(=O)N[C@H](CO)CC(C)C)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C29H33N5O6/c1-15(2)11-19(14-35)33-27(36)21-13-23(29(38)39)22(12-16(21)3)20-9-10-24(40-4)34-25(20)28(37)32-18-7-5-17(6-8-18)26(30)31/h5-10,12-13,15,19,35H,11,14H2,1-4H3,(H3,30,31)(H,32,37)(H,33,36)(H,38,39)/t19-/m0/s1 |
| InChIKey | MIVFGSZHQUSDHC-IBGZPJMESA-N |
| XLogP | 3.44 |
| TPSA | 187.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|