C36H39N5O6 — CID 18685318
benzyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]-5-[[(2S)-1-methoxy-3,3-dimethylbutan-2-yl]carbamoyl]benzoate (PubChem CID 18685318) has the molecular formula C36H39N5O6 and a molecular weight of 637.74 g/mol. Its IUPAC name is benzyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]-5-[[(2S)-1-methoxy-3,3-dimethylbutan-2-yl]carbamoyl]benzoate.
| Compound Name | benzyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]-5-[[(2S)-1-methoxy-3,3-dimethylbutan-2-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 18685318 |
| Molecular Formula | C36H39N5O6 |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | benzyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]-5-[[(2S)-1-methoxy-3,3-dimethylbutan-2-yl]carbamoyl]benzoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2nc(OC)ccc2-c2ccc(C(=O)N[C@H](COC)C(C)(C)C)cc2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C36H39N5O6/c1-36(2,3)29(21-45-4)40-33(42)24-13-16-26(28(19-24)35(44)47-20-22-9-7-6-8-10-22)27-17-18-30(46-5)41-31(27)34(43)39-25-14-11-23(12-15-25)32(37)38/h6-19,29H,20-21H2,1-5H3,(H3,37,38)(H,39,43)(H,40,42)/t29-/m1/s1 |
| InChIKey | BKTWMWLPVPKJJN-GDLZYMKVSA-N |
| XLogP | 5.44 |
| TPSA | 165.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|