About 1-N,2-N-dimethylpropane-1,2-diimine
1-N,2-N-dimethylpropane-1,2-diimine (PubChem CID 18685673) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is 1-N,2-N-dimethylpropane-1,2-diimine.
Molecular Properties
| Compound Name | 1-N,2-N-dimethylpropane-1,2-diimine |
| PubChem CID | 18685673 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 1-N,2-N-dimethylpropane-1,2-diimine |
| SMILES | C/N=C/C(C)=N/C |
| InChI | InChI=1S/C5H10N2/c1-5(7-3)4-6-2/h4H,1-3H3/b6-4+,7-5+ |
| InChIKey | PTRGIFZVAFOXBV-YDFGWWAZSA-N |
| XLogP | 0.78 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-N,2-N-dimethylpropane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,2-N-dimethylpropane-1,2-diimine?
The IUPAC name of 1-N,2-N-dimethylpropane-1,2-diimine (CID 18685673) is 1-N,2-N-dimethylpropane-1,2-diimine.
What is the SMILES notation for 1-N,2-N-dimethylpropane-1,2-diimine?
The canonical SMILES for 1-N,2-N-dimethylpropane-1,2-diimine is C/N=C/C(C)=N/C.
What is the InChIKey of 1-N,2-N-dimethylpropane-1,2-diimine?
The InChIKey is PTRGIFZVAFOXBV-YDFGWWAZSA-N. The full InChI is InChI=1S/C5H10N2/c1-5(7-3)4-6-2/h4H,1-3H3/b6-4+,7-5+.
What are the key properties of 1-N,2-N-dimethylpropane-1,2-diimine?
1-N,2-N-dimethylpropane-1,2-diimine has a molecular weight of 98.15 g/mol, XLogP of 0.78, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,2-N-dimethylpropane-1,2-diimine is sourced from PubChem (CID 18685673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).