C25H19F5N4O2 — CID 18685794
N-[3-(2,5-difluorophenyl)-6-[(E)-3-(methylaminooxy)-1-phenylprop-1-enyl]imidazo[1,2-a]pyridin-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 18685794) has the molecular formula C25H19F5N4O2 and a molecular weight of 502.44 g/mol. Its IUPAC name is N-[3-(2,5-difluorophenyl)-6-[(E)-3-(methylaminooxy)-1-phenylprop-1-enyl]imidazo[1,2-a]pyridin-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-(2,5-difluorophenyl)-6-[(E)-3-(methylaminooxy)-1-phenylprop-1-enyl]imidazo[1,2-a]pyridin-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 18685794 |
| Molecular Formula | C25H19F5N4O2 |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | N-[3-(2,5-difluorophenyl)-6-[(E)-3-(methylaminooxy)-1-phenylprop-1-enyl]imidazo[1,2-a]pyridin-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | CNOC/C=C(\c1ccccc1)c1ccc2nc(NC(=O)C(F)(F)F)c(-c3cc(F)ccc3F)n2c1 |
| InChI | InChI=1S/C25H19F5N4O2/c1-31-36-12-11-18(15-5-3-2-4-6-15)16-7-10-21-32-23(33-24(35)25(28,29)30)22(34(21)14-16)19-13-17(26)8-9-20(19)27/h2-11,13-14,31H,12H2,1H3,(H,33,35)/b18-11+ |
| InChIKey | SFXNWIHGMORZHH-WOJGMQOQSA-N |
| XLogP | 5.36 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|