C18H22N2O3U — CID 18685828
carbanide;1-methyl-N-(3-methyl-4-oxopentan-2-yl)-4-oxo-7H-quinolin-7-ide-3-carboxamide;uranium(2+) (PubChem CID 18685828) has the molecular formula C18H22N2O3U and a molecular weight of 552.41 g/mol. Its IUPAC name is carbanide;1-methyl-N-(3-methyl-4-oxopentan-2-yl)-4-oxo-7H-quinolin-7-ide-3-carboxamide;uranium(2+).
| Compound Name | carbanide;1-methyl-N-(3-methyl-4-oxopentan-2-yl)-4-oxo-7H-quinolin-7-ide-3-carboxamide;uranium(2+) |
|---|---|
| PubChem CID | 18685828 |
| Molecular Formula | C18H22N2O3U |
| Molecular Weight | 552.41 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | carbanide;1-methyl-N-(3-methyl-4-oxopentan-2-yl)-4-oxo-7H-quinolin-7-ide-3-carboxamide;uranium(2+) |
| SMILES | CC(=O)C(C)C(C)NC(=O)c1cn(C)c2c[c-]ccc2c1=O.[CH3-].[U+2] |
| InChI | InChI=1S/C17H19N2O3.CH3.U/c1-10(12(3)20)11(2)18-17(22)14-9-19(4)15-8-6-5-7-13(15)16(14)21;;/h5,7-11H,1-4H3,(H,18,22);1H3;/q2*-1;+2 |
| InChIKey | AYNMYBNZLSXVRY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|