C22H22Si — CID 18686603
10-cyclopenta-1,3-dien-1-yl-5,11,13,13-tetramethyl-13-silatetracyclo[7.5.0.02,7.012,14]tetradeca-1(9),2(7),3,5,10,12(14)-hexaene (PubChem CID 18686603) has the molecular formula C22H22Si and a molecular weight of 314.50 g/mol. Its IUPAC name is 10-cyclopenta-1,3-dien-1-yl-5,11,13,13-tetramethyl-13-silatetracyclo[7.5.0.02,7.012,14]tetradeca-1(9),2(7),3,5,10,12(14)-hexaene.
| Compound Name | 10-cyclopenta-1,3-dien-1-yl-5,11,13,13-tetramethyl-13-silatetracyclo[7.5.0.02,7.012,14]tetradeca-1(9),2(7),3,5,10,12(14)-hexaene |
|---|---|
| PubChem CID | 18686603 |
| Molecular Formula | C22H22Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 10-cyclopenta-1,3-dien-1-yl-5,11,13,13-tetramethyl-13-silatetracyclo[7.5.0.02,7.012,14]tetradeca-1(9),2(7),3,5,10,12(14)-hexaene |
| SMILES | Cc1ccc2c(c1)Cc1c(C3=CC=CC3)c(C)c3c(c1-2)[Si]3(C)C |
| InChI | InChI=1S/C22H22Si/c1-13-9-10-17-16(11-13)12-18-19(15-7-5-6-8-15)14(2)21-22(20(17)18)23(21,3)4/h5-7,9-11H,8,12H2,1-4H3 |
| InChIKey | MWAWJYOWDWFWKH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|