About 3,3-dimethylpiperidine;hydrochloride
3,3-dimethylpiperidine;hydrochloride (PubChem CID 18686627) has the molecular formula C7H16ClN
and a molecular weight of 149.67 g/mol. Its IUPAC name is 3,3-dimethylpiperidine;hydrochloride.
Molecular Properties
| Compound Name | 3,3-dimethylpiperidine;hydrochloride |
| PubChem CID | 18686627 |
| Molecular Formula | C7H16ClN |
| Molecular Weight | 149.67 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 3,3-dimethylpiperidine;hydrochloride |
| SMILES | CC1(C)CCCNC1.Cl |
| InChI | InChI=1S/C7H15N.ClH/c1-7(2)4-3-5-8-6-7;/h8H,3-6H2,1-2H3;1H |
| InChIKey | BXFKQBZPFQBCCO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.67 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-dimethylpiperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylpiperidine;hydrochloride?
The IUPAC name of 3,3-dimethylpiperidine;hydrochloride (CID 18686627) is 3,3-dimethylpiperidine;hydrochloride.
What is the SMILES notation for 3,3-dimethylpiperidine;hydrochloride?
The canonical SMILES for 3,3-dimethylpiperidine;hydrochloride is CC1(C)CCCNC1.Cl.
What is the InChIKey of 3,3-dimethylpiperidine;hydrochloride?
The InChIKey is BXFKQBZPFQBCCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.ClH/c1-7(2)4-3-5-8-6-7;/h8H,3-6H2,1-2H3;1H.
What are the key properties of 3,3-dimethylpiperidine;hydrochloride?
3,3-dimethylpiperidine;hydrochloride has a molecular weight of 149.67 g/mol, XLogP of 1.82, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylpiperidine;hydrochloride is sourced from PubChem (CID 18686627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).