About 7-bromochromen-4-one
7-bromochromen-4-one (PubChem CID 18686752) has the molecular formula C9H5BrO2
and a molecular weight of 225.04 g/mol. Its IUPAC name is 7-bromochromen-4-one.
Molecular Properties
| Compound Name | 7-bromochromen-4-one |
| PubChem CID | 18686752 |
| Molecular Formula | C9H5BrO2 |
| Molecular Weight | 225.04 g/mol |
| Exact Mass | 223.95 |
| IUPAC Name | 7-bromochromen-4-one |
| SMILES | O=c1ccoc2cc(Br)ccc12 |
| InChI | InChI=1S/C9H5BrO2/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-5H |
| InChIKey | WWAOCYNUAWVKGQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.04 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromochromen-4-one?
The IUPAC name of 7-bromochromen-4-one (CID 18686752) is 7-bromochromen-4-one.
What is the SMILES notation for 7-bromochromen-4-one?
The canonical SMILES for 7-bromochromen-4-one is O=c1ccoc2cc(Br)ccc12.
What is the InChIKey of 7-bromochromen-4-one?
The InChIKey is WWAOCYNUAWVKGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrO2/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-5H.
What are the key properties of 7-bromochromen-4-one?
7-bromochromen-4-one has a molecular weight of 225.04 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromochromen-4-one is sourced from PubChem (CID 18686752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).