C24H22N4O2S — CID 18686968
N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-pyridin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 18686968) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-pyridin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-pyridin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 18686968 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-pyridin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | c1ccc(-c2nc(NCCc3ccc4c(c3)OCO4)c3c4c(sc3n2)CCCC4)nc1 |
| InChI | InChI=1S/C24H22N4O2S/c1-2-7-20-16(5-1)21-23(26-12-10-15-8-9-18-19(13-15)30-14-29-18)27-22(28-24(21)31-20)17-6-3-4-11-25-17/h3-4,6,8-9,11,13H,1-2,5,7,10,12,14H2,(H,26,27,28) |
| InChIKey | CBGXDOJIKPVBCQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |